CAS 121830-25-9 is the registry number for 2,3,6-Trichloro-7-nitroquinoxaline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,6-trichloro-7-nitroquinoxaline (CAS 121830-25-9) is a chemical compound with the molecular formula C8H2Cl3N3O2 and a molecular weight of 278.5 g/mol. IUPAC name: 2,3,6-trichloro-7-nitroquinoxaline. InChIKey: PIJKVNVZLPYVSZ-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl3N3O2 |
|---|---|
| Molecular weight | 278.5 g/mol |
| IUPAC name | 2,3,6-trichloro-7-nitroquinoxaline |
| InChIKey | PIJKVNVZLPYVSZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1[N+](=O)[O-])Cl)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)