CAS 121848-75-7 appears in our catalog under these names: 10,10'–Dibromo–9,9'–bianthracene, 10,10'-Dibromo-9,9'-bianthracene, >98.0%(HPLC)(T), 10,10'-Dibromo-9,9'-bianthracene 98%, 10,10'-DIBROMO-9,9'-BIANTHRACENE, 10,10'-Dibromo-9,9'-bianthracene, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 100g.
9-bromo-10-(10-bromoanthracen-9-yl)anthracene (CAS 121848-75-7) is a chemical compound with the molecular formula C28H16Br2 and a molecular weight of 512.2 g/mol. IUPAC name: 9-bromo-10-(10-bromoanthracen-9-yl)anthracene. InChIKey: NPNNLGXEAGTSRN-UHFFFAOYSA-N.
| Molecular formula | C28H16Br2 |
|---|---|
| Molecular weight | 512.2 g/mol |
| IUPAC name | 9-bromo-10-(10-bromoanthracen-9-yl)anthracene |
| InChIKey | NPNNLGXEAGTSRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Br)C4=C5C=CC=CC5=C(C6=CC=CC=C64)Br |
Computed by PubChem (NCBI)