CAS 1218549-05-3 is the registry number for (3S)-1-Cyclopentylpiperidin-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S)-1-cyclopentylpiperidin-3-amine (CAS 1218549-05-3) is a chemical compound with the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. IUPAC name: (3S)-1-cyclopentylpiperidin-3-amine. InChIKey: BPEXQYURTRYAMW-VIFPVBQESA-N.
| Molecular formula | C10H20N2 |
|---|---|
| Molecular weight | 168.28 g/mol |
| IUPAC name | (3S)-1-cyclopentylpiperidin-3-amine |
| InChIKey | BPEXQYURTRYAMW-VIFPVBQESA-N |
| SMILES | C1CCC(C1)N2CCC[C@@H](C2)N |
Computed by PubChem (NCBI)