Products 1218615-41-8
CAS 1218615-41-8 is the registry number for Rel-(1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxylic acid (CAS 1218615-41-8) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxylic acid. InChIKey: NLGVWWXDDJKQPK-SVRRBLITSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxylic acid |
| InChIKey | NLGVWWXDDJKQPK-SVRRBLITSA-N |
| SMILES | C1C[C@@H]2CC[C@](C1)(N2)C(=O)O |
Computed by PubChem (NCBI)