Products 1218651-70-7

CAS 1218651-70-7 is the registry number for 1-Isopropylpiperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

1-propan-2-ylpiperidine-2-carboxylic acid (CAS 1218651-70-7) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: 1-propan-2-ylpiperidine-2-carboxylic acid. InChIKey: QFLCTAXQTJMMJD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2
Molecular weight171.24 g/mol
IUPAC name1-propan-2-ylpiperidine-2-carboxylic acid
InChIKeyQFLCTAXQTJMMJD-UHFFFAOYSA-N
SMILESCC(C)N1CCCCC1C(=O)O

Computed by PubChem (NCBI)