CAS 121876-98-0 is the registry number for N,N'-Bis[(dimethylamino)methylene]thiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(1E,3E)-1,3-bis(dimethylaminomethylidene)thiourea (CAS 121876-98-0) is a chemical compound with the molecular formula C7H14N4S and a molecular weight of 186.28 g/mol. IUPAC name: (1E,3E)-1,3-bis(dimethylaminomethylidene)thiourea. InChIKey: XZJKOXKEGOLKDB-XVYDYJIPSA-N.
| Molecular formula | C7H14N4S |
|---|---|
| Molecular weight | 186.28 g/mol |
| IUPAC name | (1E,3E)-1,3-bis(dimethylaminomethylidene)thiourea |
| InChIKey | XZJKOXKEGOLKDB-XVYDYJIPSA-N |
| SMILES | CN(/C=N/C(=S)/N=C/N(C)C)C |
Computed by PubChem (NCBI)