CAS 1218789-47-9 appears in our catalog under these names: 3-Chloro-5-(ethoxycarbonymethoxy)phenylboronic acid, pinacol ester, 98%, 3-Chloro-5-(ethoxycarbonymethoxy)phenylboronic acid, pinacol ester, 98%, 98%, Ethyl 2-(3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (CAS 1218789-47-9) is a chemical compound with the molecular formula C16H22BClO5 and a molecular weight of 340.6 g/mol. IUPAC name: ethyl 2-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate. InChIKey: KDZLXLNAHRVMPT-UHFFFAOYSA-N.
| Molecular formula | C16H22BClO5 |
|---|---|
| Molecular weight | 340.6 g/mol |
| IUPAC name | ethyl 2-[3-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| InChIKey | KDZLXLNAHRVMPT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Cl)OCC(=O)OCC |
Computed by PubChem (NCBI)