CAS 1218790-43-2 is the registry number for 1-(p-Toluenesulfonyl)pyrrole-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 1218790-43-2) is a chemical compound with the molecular formula C17H22BNO4S and a molecular weight of 347.2 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: SBOBTZKFRFZIPG-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO4S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | SBOBTZKFRFZIPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CN2S(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)