CAS 1218790-54-5 is the registry number for [1,2,5]Oxadiazolo[3,4-b]pyridin-6-ylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,5]oxadiazolo[3,4-b]pyridine (CAS 1218790-54-5) is a chemical compound with the molecular formula C11H14BN3O3 and a molecular weight of 247.06 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,5]oxadiazolo[3,4-b]pyridine. InChIKey: WWVCWPSNDSQGJQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BN3O3 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,2,5]oxadiazolo[3,4-b]pyridine |
| InChIKey | WWVCWPSNDSQGJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NON=C3N=C2 |
Computed by PubChem (NCBI)