CAS 1218790-68-1 is the registry number for 2-Isobutoxy-5-(trifluoromethyl)pyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.
[2-(2-methylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1218790-68-1) is a chemical compound with the molecular formula C10H13BF3NO3 and a molecular weight of 263.02 g/mol. IUPAC name: [2-(2-methylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: XNIVHYIBMDZMCA-UHFFFAOYSA-N.
| Molecular formula | C10H13BF3NO3 |
|---|---|
| Molecular weight | 263.02 g/mol |
| IUPAC name | [2-(2-methylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | XNIVHYIBMDZMCA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1OCC(C)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)