Products 1218790-68-1

CAS 1218790-68-1 is the registry number for 2-Isobutoxy-5-(trifluoromethyl)pyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[2-(2-methylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 1218790-68-1) is a chemical compound with the molecular formula C10H13BF3NO3 and a molecular weight of 263.02 g/mol. IUPAC name: [2-(2-methylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: XNIVHYIBMDZMCA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BF3NO3
Molecular weight263.02 g/mol
IUPAC name[2-(2-methylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]boronic acid
InChIKeyXNIVHYIBMDZMCA-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1OCC(C)C)C(F)(F)F)(O)O

Computed by PubChem (NCBI)