CAS 1218790-74-9 appears in our catalog under these names: Di(3-fluoro-2-trifluoromethyl)phenylborinic acid, 98%, Bis(3-fluoro-2-(trifluoromethyl)phenyl)(hydroxy)borane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
Bis[3-fluoro-2-(trifluoromethyl)phenyl]borinic acid (CAS 1218790-74-9) is a chemical compound with the molecular formula C14H7BF8O and a molecular weight of 354.00 g/mol. IUPAC name: bis[3-fluoro-2-(trifluoromethyl)phenyl]borinic acid. InChIKey: CPVWDJSKJMCXQY-UHFFFAOYSA-N.
| Molecular formula | C14H7BF8O |
|---|---|
| Molecular weight | 354.00 g/mol |
| IUPAC name | bis[3-fluoro-2-(trifluoromethyl)phenyl]borinic acid |
| InChIKey | CPVWDJSKJMCXQY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)C(F)(F)F)(C2=C(C(=CC=C2)F)C(F)(F)F)O |
Computed by PubChem (NCBI)