Products 1218790-76-1

CAS 1218790-76-1 is the registry number for 5-Amino-2,4-difluorophenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(5-amino-2,4-difluorophenyl)boronic acid;hydrochloride (CAS 1218790-76-1) is a chemical compound with the molecular formula C6H7BClF2NO2 and a molecular weight of 209.39 g/mol. IUPAC name: (5-amino-2,4-difluorophenyl)boronic acid;hydrochloride. InChIKey: HAKZXGNYHOUDRS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BClF2NO2
Molecular weight209.39 g/mol
IUPAC name(5-amino-2,4-difluorophenyl)boronic acid;hydrochloride
InChIKeyHAKZXGNYHOUDRS-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)F)N)(O)O.Cl

Computed by PubChem (NCBI)