CAS 1218790-76-1 is the registry number for 5-Amino-2,4-difluorophenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(5-amino-2,4-difluorophenyl)boronic acid;hydrochloride (CAS 1218790-76-1) is a chemical compound with the molecular formula C6H7BClF2NO2 and a molecular weight of 209.39 g/mol. IUPAC name: (5-amino-2,4-difluorophenyl)boronic acid;hydrochloride. InChIKey: HAKZXGNYHOUDRS-UHFFFAOYSA-N.
| Molecular formula | C6H7BClF2NO2 |
|---|---|
| Molecular weight | 209.39 g/mol |
| IUPAC name | (5-amino-2,4-difluorophenyl)boronic acid;hydrochloride |
| InChIKey | HAKZXGNYHOUDRS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)F)N)(O)O.Cl |
Computed by PubChem (NCBI)