CAS 1218791-33-3 is the registry number for 2-Acetamido-5-acrylamidophenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
N-[4-acetamido-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enamide (CAS 1218791-33-3) is a chemical compound with the molecular formula C17H23BN2O4 and a molecular weight of 330.2 g/mol. IUPAC name: N-[4-acetamido-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enamide. InChIKey: BKLJRACQSRDTRR-UHFFFAOYSA-N.
| Molecular formula | C17H23BN2O4 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | N-[4-acetamido-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enamide |
| InChIKey | BKLJRACQSRDTRR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)NC(=O)C=C)NC(=O)C |
Computed by PubChem (NCBI)