CAS 1218791-40-2 is the registry number for N,N,N-Trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenaminium iodide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Trimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium iodide (CAS 1218791-40-2) is a chemical compound with the molecular formula C15H25BINO2 and a molecular weight of 389.08 g/mol. IUPAC name: trimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium iodide. InChIKey: DIOMMQPOFKDACP-UHFFFAOYSA-M.
| Molecular formula | C15H25BINO2 |
|---|---|
| Molecular weight | 389.08 g/mol |
| IUPAC name | trimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azanium iodide |
| InChIKey | DIOMMQPOFKDACP-UHFFFAOYSA-M |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)