CAS 1218908-72-5 is the registry number for Potassium cycloheptyltrifluoroborate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Potassium cycloheptyl(trifluoro)boranuide (CAS 1218908-72-5) is a chemical compound with the molecular formula C7H13BF3K and a molecular weight of 204.08 g/mol. IUPAC name: potassium cycloheptyl(trifluoro)boranuide. InChIKey: DQQLVLJWFMWZNO-UHFFFAOYSA-N.
| Molecular formula | C7H13BF3K |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | potassium cycloheptyl(trifluoro)boranuide |
| InChIKey | DQQLVLJWFMWZNO-UHFFFAOYSA-N |
| SMILES | [B-](C1CCCCCC1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)