CAS 1218918-76-3 is the registry number for N-((4-Fluorophenyl)sulfonyl)-D-aspartic Acid 1,4-Dimethyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Dimethyl (2R)-2-[(4-fluorophenyl)sulfonylamino]butanedioate (CAS 1218918-76-3) is a chemical compound with the molecular formula C12H14FNO6S and a molecular weight of 319.31 g/mol. IUPAC name: dimethyl (2R)-2-[(4-fluorophenyl)sulfonylamino]butanedioate. InChIKey: CHKPFLCKTIQFNL-SNVBAGLBSA-N.
| Molecular formula | C12H14FNO6S |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | dimethyl (2R)-2-[(4-fluorophenyl)sulfonylamino]butanedioate |
| InChIKey | CHKPFLCKTIQFNL-SNVBAGLBSA-N |
| SMILES | COC(=O)C[C@H](C(=O)OC)NS(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)