CAS 121898-64-4 appears in our catalog under these names: Tris(4–methoxy–3,5–dimethylphenyl)phosphine, TRIS(4-METHOXY-3,5-DIMETHYLPHENYL)PHOSP&, Tris(4-methoxy-3,5-dimethylphenyl)phosphine 98%, PHOSPHINE, TRIS(4-METHOXY-3,5-DIMETHYLPHENYL)-, 96%, Tris(4-Methoxy-3,5-Dimethylphenyl)Phosphine, 98%, 98%. Offered by: GLPBio, Sigma-Aldrich, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 500mg, 5g, 250mg.
Tris(4-methoxy-3,5-dimethylphenyl)phosphane (CAS 121898-64-4) is a chemical compound with the molecular formula C27H33O3P and a molecular weight of 436.5 g/mol. IUPAC name: tris(4-methoxy-3,5-dimethylphenyl)phosphane. InChIKey: BDGUINGZRGNLPD-UHFFFAOYSA-N.
| Molecular formula | C27H33O3P |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | tris(4-methoxy-3,5-dimethylphenyl)phosphane |
| InChIKey | BDGUINGZRGNLPD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C)P(C2=CC(=C(C(=C2)C)OC)C)C3=CC(=C(C(=C3)C)OC)C |
Computed by PubChem (NCBI)