CAS 1219019-28-9 is the registry number for (6S)-6,7-Dihydro-5H-Pyrrolo(1,2-a)imidazol-6-amine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-6-amine;hydrochloride (CAS 1219019-28-9) is a chemical compound with the molecular formula C6H10ClN3 and a molecular weight of 159.62 g/mol. IUPAC name: (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-6-amine;hydrochloride. InChIKey: QFSDEEQXHVJGNL-JEDNCBNOSA-N.
| Molecular formula | C6H10ClN3 |
|---|---|
| Molecular weight | 159.62 g/mol |
| IUPAC name | (6S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-6-amine;hydrochloride |
| InChIKey | QFSDEEQXHVJGNL-JEDNCBNOSA-N |
| SMILES | C1[C@@H](CN2C1=NC=C2)N.Cl |
Computed by PubChem (NCBI)