CAS 1219021-46-1 appears in our catalog under these names: Bicyclo[2.2.1]hept-2-en-2-ylboronic acid pinacol ester, 95%, Bicyclo(2.2.1)hept-2-en-2-ylboronic acid pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
2-(2-bicyclo[2.2.1]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1219021-46-1) is a chemical compound with the molecular formula C13H21BO2 and a molecular weight of 220.12 g/mol. IUPAC name: 2-(2-bicyclo[2.2.1]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RDRIINBHGGSOPA-UHFFFAOYSA-N.
| Molecular formula | C13H21BO2 |
|---|---|
| Molecular weight | 220.12 g/mol |
| IUPAC name | 2-(2-bicyclo[2.2.1]hept-2-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RDRIINBHGGSOPA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3CCC2C3 |
Computed by PubChem (NCBI)