Products 1219032-20-8
CAS 1219032-20-8 appears in our catalog under these names: 17-phenyl trinor Prostaglandin E2 ethyl amide, 17–phenyl trinor Prostaglandin E2 ethyl amide. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 5 mg, 1 mg.
(Z)-N-ethyl-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide (CAS 1219032-20-8) is a chemical compound with the molecular formula C25H35NO4 and a molecular weight of 413.5 g/mol. IUPAC name: (Z)-N-ethyl-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide. InChIKey: XKYMIHJCJJUECW-XYOQMNIYSA-N.
| Molecular formula | C25H35NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (Z)-N-ethyl-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide |
| InChIKey | XKYMIHJCJJUECW-XYOQMNIYSA-N |
| SMILES | CCNC(=O)CCC/C=C\C[C@@H]1[C@H]([C@@H](CC1=O)O)/C=C/[C@H](CCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)