CAS 1219119-52-4 is the registry number for Ethyl 2-fluoro-4-(methylamino)-5-nitrobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-fluoro-4-(methylamino)-5-nitrobenzoate (CAS 1219119-52-4) is a chemical compound with the molecular formula C10H11FN2O4 and a molecular weight of 242.20 g/mol. IUPAC name: ethyl 2-fluoro-4-(methylamino)-5-nitrobenzoate. InChIKey: GYOAZFXTKIPZQD-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O4 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | ethyl 2-fluoro-4-(methylamino)-5-nitrobenzoate |
| InChIKey | GYOAZFXTKIPZQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1F)NC)[N+](=O)[O-] |
Computed by PubChem (NCBI)