CAS 1219151-49-1 is the registry number for 4-Methylbenzotriazole-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
4-(trideuteriomethyl)-2H-benzotriazole (CAS 1219151-49-1) is a chemical compound with the molecular formula C7H7N3 and a molecular weight of 136.17 g/mol. IUPAC name: 4-(trideuteriomethyl)-2H-benzotriazole. InChIKey: CMGDVUCDZOBDNL-FIBGUPNXSA-N.
| Molecular formula | C7H7N3 |
|---|---|
| Molecular weight | 136.17 g/mol |
| IUPAC name | 4-(trideuteriomethyl)-2H-benzotriazole |
| InChIKey | CMGDVUCDZOBDNL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=CC2=NNN=C21 |
Computed by PubChem (NCBI)