CAS 1219187-51-5 appears in our catalog under these names: D,L-Alanosine-15N2, DL-Alanosine-15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(2-amino-2-carboxyethyl)-(15N)hydroxyimino-oxido(15N)azanium (CAS 1219187-51-5) is a chemical compound with the molecular formula C3H7N3O4 and a molecular weight of 151.09 g/mol. IUPAC name: (2-amino-2-carboxyethyl)-(15N)hydroxyimino-oxido(15N)azanium. InChIKey: ZGNLFUXWZJGETL-MPOCSFTDSA-N.
| Molecular formula | C3H7N3O4 |
|---|---|
| Molecular weight | 151.09 g/mol |
| IUPAC name | (2-amino-2-carboxyethyl)-(15N)hydroxyimino-oxido(15N)azanium |
| InChIKey | ZGNLFUXWZJGETL-MPOCSFTDSA-N |
| SMILES | C(C(C(=O)O)N)[15N+](=[15N]O)[O-] |
Computed by PubChem (NCBI)