CAS 1219192-16-1 appears in our catalog under these names: Triglyme-d6, 2,5,8,11-Tetraoxadodecane-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
1,2-bis[2-(trideuteriomethoxy)ethoxy]ethane (CAS 1219192-16-1) is a chemical compound with the molecular formula C8H18O4 and a molecular weight of 184.26 g/mol. IUPAC name: 1,2-bis[2-(trideuteriomethoxy)ethoxy]ethane. InChIKey: YFNKIDBQEZZDLK-WFGJKAKNSA-N.
| Molecular formula | C8H18O4 |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | 1,2-bis[2-(trideuteriomethoxy)ethoxy]ethane |
| InChIKey | YFNKIDBQEZZDLK-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OCCOCCOCCOC([2H])([2H])[2H] |
Computed by PubChem (NCBI)