CAS 12193-47-4 appears in our catalog under these names: Strontium Acetylacetonate, 98%, Strontium acetylacetonate hydrate, Sr(acac)2 98% (xhydrate). Offered by: Chemat Brand, GLPBio, Ambeed. Available pack sizes: on request, 10g, 500g, 25g, 100g.
Strontium bis((Z)-4-oxopent-2-en-2-olate) (CAS 12193-47-4) is a chemical compound with the molecular formula C10H14O4Sr and a molecular weight of 285.84 g/mol. IUPAC name: strontium bis((Z)-4-oxopent-2-en-2-olate). InChIKey: UMBFGWVRZIHXCK-FDGPNNRMSA-L.
| Molecular formula | C10H14O4Sr |
|---|---|
| Molecular weight | 285.84 g/mol |
| IUPAC name | strontium bis((Z)-4-oxopent-2-en-2-olate) |
| InChIKey | UMBFGWVRZIHXCK-FDGPNNRMSA-L |
| SMILES | C/C(=C/C(=O)C)/[O-].C/C(=C/C(=O)C)/[O-].[Sr+2] |
Computed by PubChem (NCBI)