Products 1219423-91-2
CAS 1219423-91-2 appears in our catalog under these names: Clopidogrel Amide-d4, >95% (HPLC), rac-Clopidogrel Amide-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide (CAS 1219423-91-2) is a chemical compound with the molecular formula C15H15ClN2OS and a molecular weight of 310.8 g/mol. IUPAC name: 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide. InChIKey: SRKXAUBVRPEIQR-RHQRLBAQSA-N.
| Molecular formula | C15H15ClN2OS |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 2-(2-chloro-3,4,5,6-tetradeuteriophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
| InChIKey | SRKXAUBVRPEIQR-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(C(=O)N)N2CCC3=C(C2)C=CS3)Cl)[2H])[2H] |
Computed by PubChem (NCBI)