Products 1219425-22-5

CAS 1219425-22-5 appears in our catalog under these names: 1,3-Dimethylpiperazin-2-one hydrochloride, 95%, 1,3-Dimethylpiperazin-2-one hydrochloride, 97%, 1,3-Dimethylpiperazin-2-one hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

1,3-dimethylpiperazin-2-one;hydrochloride (CAS 1219425-22-5) is a chemical compound with the molecular formula C6H13ClN2O and a molecular weight of 164.63 g/mol. IUPAC name: 1,3-dimethylpiperazin-2-one;hydrochloride. InChIKey: RPYFFGWXUDPLTF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H13ClN2O
Molecular weight164.63 g/mol
IUPAC name1,3-dimethylpiperazin-2-one;hydrochloride
InChIKeyRPYFFGWXUDPLTF-UHFFFAOYSA-N
SMILESCC1C(=O)N(CCN1)C.Cl

Computed by PubChem (NCBI)