Products 1219440-73-9

CAS 1219440-73-9 is the registry number for Fmoc-L-Lys(Hexynoyl)-OH. Offered by: Iris Biotech. Available pack sizes: 500mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(hex-5-ynoylamino)hexanoic acid (CAS 1219440-73-9) is a chemical compound with the molecular formula C27H30N2O5 and a molecular weight of 462.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(hex-5-ynoylamino)hexanoic acid. InChIKey: WANJIJMRRRXCST-DEOSSOPVSA-N.

Identity
Molecular formulaC27H30N2O5
Molecular weight462.5 g/mol
IUPAC name(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(hex-5-ynoylamino)hexanoic acid
InChIKeyWANJIJMRRRXCST-DEOSSOPVSA-N
SMILESC#CCCCC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)