Products 1219576-50-7
CAS 1219576-50-7 is the registry number for CREBBP-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-acetylphenyl)-4,5-dimethyl-2-(tetrazol-1-yl)thiophene-3-carboxamide (CAS 1219576-50-7) is a chemical compound with the molecular formula C16H15N5O2S and a molecular weight of 341.4 g/mol. IUPAC name: N-(3-acetylphenyl)-4,5-dimethyl-2-(tetrazol-1-yl)thiophene-3-carboxamide. InChIKey: LJTPBXLEODIXKV-UHFFFAOYSA-N.
| Molecular formula | C16H15N5O2S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | N-(3-acetylphenyl)-4,5-dimethyl-2-(tetrazol-1-yl)thiophene-3-carboxamide |
| InChIKey | LJTPBXLEODIXKV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)NC2=CC=CC(=C2)C(=O)C)N3C=NN=N3)C |
Computed by PubChem (NCBI)