Products 1219794-62-3
CAS 1219794-62-3 appears in our catalog under these names: N-Methyl-d3-glycine-2,2-d2 HCl, 98 atom % D, min 98% Chemical Purity, 2-(Methylamino)acetic acid-d5 (hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1mg, 5mg.
2,2-dideuterio-2-(trideuteriomethylamino)acetic acid;hydrochloride (CAS 1219794-62-3) is a chemical compound with the molecular formula C3H8ClNO2 and a molecular weight of 130.58 g/mol. IUPAC name: 2,2-dideuterio-2-(trideuteriomethylamino)acetic acid;hydrochloride. InChIKey: WVKIFIROCHIWAY-LUIAAVAXSA-N.
| Molecular formula | C3H8ClNO2 |
|---|---|
| Molecular weight | 130.58 g/mol |
| IUPAC name | 2,2-dideuterio-2-(trideuteriomethylamino)acetic acid;hydrochloride |
| InChIKey | WVKIFIROCHIWAY-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])NC([2H])([2H])C(=O)O.Cl |
Computed by PubChem (NCBI)