Products 1219795-04-6
CAS 1219795-04-6 appears in our catalog under these names: 4-n-Butylphenol-2,3,5,6-d4,OD, 98 atom % D, min 98% Chemical Purity, 4-Butylphenol-d5, 98.29%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 5 mg, 10 mg, 1 mg.
1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene (CAS 1219795-04-6) is a chemical compound with the molecular formula C10H14O and a molecular weight of 155.25 g/mol. IUPAC name: 1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene. InChIKey: CYYZDBDROVLTJU-QBYFNKCPSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 155.25 g/mol |
| IUPAC name | 1-butyl-2,3,5,6-tetradeuterio-4-deuteriooxybenzene |
| InChIKey | CYYZDBDROVLTJU-QBYFNKCPSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCC)[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)