Products 1219795-10-4
CAS 1219795-10-4 appears in our catalog under these names: (±)-2-Methylbutyryl-d9 Chloride, 98 atom % D, min 98% Chemical Purity, (±)-2-Methylbutyryl chloride-d9. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoyl chloride (CAS 1219795-10-4) is a chemical compound with the molecular formula C5H9ClO and a molecular weight of 129.63 g/mol. IUPAC name: 2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoyl chloride. InChIKey: XRPVXVRWIDOORM-CBZKUFJVSA-N.
| Molecular formula | C5H9ClO |
|---|---|
| Molecular weight | 129.63 g/mol |
| IUPAC name | 2,3,3,4,4,4-hexadeuterio-2-(trideuteriomethyl)butanoyl chloride |
| InChIKey | XRPVXVRWIDOORM-CBZKUFJVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C(=O)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)