Products 1219795-13-7
CAS 1219795-13-7 appears in our catalog under these names: (±)-1-Amino-2-propanol-1,1,2,3,3,3-d6, >95% (GC), (±)-1-Amino-2-propanol-1,1,2,3,3,3-d6, 98 atom % D, min 98% Chemical Purity, 1-Aminopropan-2-ol-d6. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 2 mg, 1 mg, 10 mg.
1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol (CAS 1219795-13-7) is a chemical compound with the molecular formula C3H9NO and a molecular weight of 81.15 g/mol. IUPAC name: 1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol. InChIKey: HXKKHQJGJAFBHI-LIDOUZCJSA-N.
| Molecular formula | C3H9NO |
|---|---|
| Molecular weight | 81.15 g/mol |
| IUPAC name | 1-amino-1,1,2,3,3,3-hexadeuteriopropan-2-ol |
| InChIKey | HXKKHQJGJAFBHI-LIDOUZCJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])N)O |
Computed by PubChem (NCBI)