Products 1219795-14-8
CAS 1219795-14-8 appears in our catalog under these names: N,N-Dimethyl-d3-glycine HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, N,N-Dimethylglycine-d3 (hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1mg, 5mg.
2-[methyl(trideuteriomethyl)amino]acetic acid;hydrochloride (CAS 1219795-14-8) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 142.60 g/mol. IUPAC name: 2-[methyl(trideuteriomethyl)amino]acetic acid;hydrochloride. InChIKey: FKASAVXZZLJTNX-NIIDSAIPSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 142.60 g/mol |
| IUPAC name | 2-[methyl(trideuteriomethyl)amino]acetic acid;hydrochloride |
| InChIKey | FKASAVXZZLJTNX-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CC(=O)O.Cl |
Computed by PubChem (NCBI)