CAS 1219795-23-9 appears in our catalog under these names: 2-Bromoisobutyric-d6 Acid, 2-Bromo-2-methyl-d3-propionic-3,3,3-d3 Acid, 99 atom % D, min 98% Chemical Purity, 2-Bromo-2-methylpropanoic acid-d6, 98.36%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 250mg, 25mg, 0,5g, 0,25g, 50 mg, 25 mg, 10 mg, 100 mg.
2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid (CAS 1219795-23-9) is a chemical compound with the molecular formula C4H7BrO2 and a molecular weight of 173.04 g/mol. IUPAC name: 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid. InChIKey: XXSPGBOGLXKMDU-WFGJKAKNSA-N.
| Molecular formula | C4H7BrO2 |
|---|---|
| Molecular weight | 173.04 g/mol |
| IUPAC name | 2-bromo-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
| InChIKey | XXSPGBOGLXKMDU-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)