Products 1219795-25-1
CAS 1219795-25-1 appears in our catalog under these names: 2-Methoxynaphthalene-1,3,4,5,6,7,8-d7, 98 atom % D, min 98% Chemical Purity, 2-Methoxynaphthalene-d7. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,2,3,4,5,6,8-heptadeuterio-7-methoxynaphthalene (CAS 1219795-25-1) is a chemical compound with the molecular formula C11H10O and a molecular weight of 165.24 g/mol. IUPAC name: 1,2,3,4,5,6,8-heptadeuterio-7-methoxynaphthalene. InChIKey: LUZDYPLAQQGJEA-CFWCETGYSA-N.
| Molecular formula | C11H10O |
|---|---|
| Molecular weight | 165.24 g/mol |
| IUPAC name | 1,2,3,4,5,6,8-heptadeuterio-7-methoxynaphthalene |
| InChIKey | LUZDYPLAQQGJEA-CFWCETGYSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])OC)[2H])[2H])[2H] |
Computed by PubChem (NCBI)