Products 1219795-34-2
CAS 1219795-34-2 appears in our catalog under these names: 4-Tolyl-d4-sulfonamide, >95% (HPLC), p-Toluene-2,3,5,6-d4-sulfonamide, 98 atom % D, min 98% Chemical Purity, 4-Tolyl-d4-sulfonamide. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 0,25g, 0,1g, 10 mg, 100 mg, 25 mg.
2,3,5,6-tetradeuterio-4-methylbenzenesulfonamide (CAS 1219795-34-2) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 175.24 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-methylbenzenesulfonamide. InChIKey: LMYRWZFENFIFIT-QFFDRWTDSA-N.
| Molecular formula | C7H9NO2S |
|---|---|
| Molecular weight | 175.24 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-methylbenzenesulfonamide |
| InChIKey | LMYRWZFENFIFIT-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])[2H])S(=O)(=O)N)[2H] |
Computed by PubChem (NCBI)