CAS 1219795-37-5 appears in our catalog under these names: Trimetazidine–d8 dihydrochloride, Trimetazidine-d8 DiHCl, Trimetazidine-d8 Dihydrochloride, >95% (HPLC), Trimetazidine-d8 2HCl (piperazine-d8), 98 atom % D, min 98% Chemical Purity, Trimetazidine-d8 dihydrochloride. Offered by: GLPBio, Chemat Brand, TRC, CDN, Biosynth. Available pack sizes: 5mg, on request, 10mg, 1mg, 0,05g, 0,01g, 25mg, 50mg.
2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride (CAS 1219795-37-5) is a chemical compound with the molecular formula C14H24Cl2N2O3 and a molecular weight of 347.3 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride. InChIKey: VYFLPFGUVGMBEP-IKGFOUCPSA-N.
| Molecular formula | C14H24Cl2N2O3 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine;dihydrochloride |
| InChIKey | VYFLPFGUVGMBEP-IKGFOUCPSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])CC2=C(C(=C(C=C2)OC)OC)OC)([2H])[2H])[2H].Cl.Cl |
Computed by PubChem (NCBI)