Products 1219795-45-5
CAS 1219795-45-5 appears in our catalog under these names: Diflubenzuron-d4 (4-chlorophenyl-d4), >95% (HPLC), Diflubenzuron-d4 (4-chlorophenyl-d4), 99 atom % D, min 98% Chemical Purity, Diflubenzuron-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1 mg.
N-[(4-chloro-2,3,5,6-tetradeuteriophenyl)carbamoyl]-2,6-difluorobenzamide (CAS 1219795-45-5) is a chemical compound with the molecular formula C14H9ClF2N2O2 and a molecular weight of 314.71 g/mol. IUPAC name: N-[(4-chloro-2,3,5,6-tetradeuteriophenyl)carbamoyl]-2,6-difluorobenzamide. InChIKey: QQQYTWIFVNKMRW-UGWFXTGHSA-N.
| Molecular formula | C14H9ClF2N2O2 |
|---|---|
| Molecular weight | 314.71 g/mol |
| IUPAC name | N-[(4-chloro-2,3,5,6-tetradeuteriophenyl)carbamoyl]-2,6-difluorobenzamide |
| InChIKey | QQQYTWIFVNKMRW-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)NC(=O)C2=C(C=CC=C2F)F)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)