CAS 1219795-46-6 appears in our catalog under these names: Tetrahydro-4H-pyran-4-ol-3,3,4,5,5-d5, 98 atom % D, min 98% Chemical Purity, Tetrahydro-2H-pyran-4-ol-d5, 98.3%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg, 10 mg, 5 mg.
3,3,4,5,5-pentadeuteriooxan-4-ol (CAS 1219795-46-6) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 107.16 g/mol. IUPAC name: 3,3,4,5,5-pentadeuteriooxan-4-ol. InChIKey: LMYJGUNNJIDROI-QJWYSIDNSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 107.16 g/mol |
| IUPAC name | 3,3,4,5,5-pentadeuteriooxan-4-ol |
| InChIKey | LMYJGUNNJIDROI-QJWYSIDNSA-N |
| SMILES | [2H]C1(COCC(C1([2H])O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)