CAS 1219795-48-8 appears in our catalog under these names: 4-(Trifluoromethyl)aniline-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, 4–(Trifluoromethyl)aniline–d4, 4-(Trifluoromethyl)aniline-d4, 99.23%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 25mg, 5mg, 5 mg, 25 mg, 10 mg.
2,3,5,6-tetradeuterio-4-(trifluoromethyl)aniline (CAS 1219795-48-8) is a chemical compound with the molecular formula C7H6F3N and a molecular weight of 165.15 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trifluoromethyl)aniline. InChIKey: ODGIMMLDVSWADK-RHQRLBAQSA-N.
| Molecular formula | C7H6F3N |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trifluoromethyl)aniline |
| InChIKey | ODGIMMLDVSWADK-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(F)(F)F)[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)