Products 1219795-50-2
CAS 1219795-50-2 appears in our catalog under these names: 2-Nitrobenzonitrile-d4, 2-Nitrobenzonitrile-d4, 99 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,25g, 0,1g.
2,3,4,5-tetradeuterio-6-nitrobenzonitrile (CAS 1219795-50-2) is a chemical compound with the molecular formula C7H4N2O2 and a molecular weight of 152.14 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitrobenzonitrile. InChIKey: SWBDKCMOLSUXRH-RHQRLBAQSA-N.
| Molecular formula | C7H4N2O2 |
|---|---|
| Molecular weight | 152.14 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-nitrobenzonitrile |
| InChIKey | SWBDKCMOLSUXRH-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C#N)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)