CAS 1219795-51-3 appears in our catalog under these names: 5-Bromo-6-chlorobenzene-1,2,3,4-d4, 2-Bromochlorobenzene-d4, 98 atom % D, min 98% Chemical Purity, 1–Bromo–2–chlorobenzene–d4, 1-Bromo-2-chlorobenzene-d4, 99.83%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 1g, 0,5g, 25mg, 100 mg, 25 mg.
1-bromo-2-chloro-3,4,5,6-tetradeuteriobenzene (CAS 1219795-51-3) is a chemical compound with the molecular formula C6H4BrCl and a molecular weight of 195.48 g/mol. IUPAC name: 1-bromo-2-chloro-3,4,5,6-tetradeuteriobenzene. InChIKey: QBELEDRHMPMKHP-RHQRLBAQSA-N.
| Molecular formula | C6H4BrCl |
|---|---|
| Molecular weight | 195.48 g/mol |
| IUPAC name | 1-bromo-2-chloro-3,4,5,6-tetradeuteriobenzene |
| InChIKey | QBELEDRHMPMKHP-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)Br)[2H])[2H] |
Computed by PubChem (NCBI)