Products 1219798-42-1
CAS 1219798-42-1 appears in our catalog under these names: (±)-Tetrahydro-2-furoic-d7 Acid, 98 atom % D, min 98% Chemical Purity, Tetrahydrofuran-2-carboxylic acid-d7. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2,3,3,4,4,5,5-heptadeuteriooxolane-2-carboxylic acid (CAS 1219798-42-1) is a chemical compound with the molecular formula C5H8O3 and a molecular weight of 123.16 g/mol. IUPAC name: 2,3,3,4,4,5,5-heptadeuteriooxolane-2-carboxylic acid. InChIKey: UJJLJRQIPMGXEZ-VNEWRNQKSA-N.
| Molecular formula | C5H8O3 |
|---|---|
| Molecular weight | 123.16 g/mol |
| IUPAC name | 2,3,3,4,4,5,5-heptadeuteriooxolane-2-carboxylic acid |
| InChIKey | UJJLJRQIPMGXEZ-VNEWRNQKSA-N |
| SMILES | [2H]C1(C(C(OC1([2H])[2H])([2H])C(=O)O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)