Products 1219798-47-6
CAS 1219798-47-6 appears in our catalog under these names: 3-(Trifluoromethyl)phenol-2,4,6-d3,OD, 98 atom % D, min 98% Chemical Purity, 3-(Trifluoromethyl)phenol-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg.
1,3,5-trideuterio-2-deuteriooxy-4-(trifluoromethyl)benzene (CAS 1219798-47-6) is a chemical compound with the molecular formula C7H5F3O and a molecular weight of 166.13 g/mol. IUPAC name: 1,3,5-trideuterio-2-deuteriooxy-4-(trifluoromethyl)benzene. InChIKey: UGEJOEBBMPOJMT-KVJLOAJYSA-N.
| Molecular formula | C7H5F3O |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 1,3,5-trideuterio-2-deuteriooxy-4-(trifluoromethyl)benzene |
| InChIKey | UGEJOEBBMPOJMT-KVJLOAJYSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1C(F)(F)F)[2H])O[2H])[2H] |
Computed by PubChem (NCBI)