Products 1219798-59-0
CAS 1219798-59-0 appears in our catalog under these names: p-Tolyl-d7 Isocyanate, 98 atom % D, min 98% Chemical Purity, Isocyanic acid, p-tolyl ester-d7. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,2,4,5-tetradeuterio-3-isocyanato-6-(trideuteriomethyl)benzene (CAS 1219798-59-0) is a chemical compound with the molecular formula C8H7NO and a molecular weight of 140.19 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-isocyanato-6-(trideuteriomethyl)benzene. InChIKey: MGYGFNQQGAQEON-AAYPNNLASA-N.
| Molecular formula | C8H7NO |
|---|---|
| Molecular weight | 140.19 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-isocyanato-6-(trideuteriomethyl)benzene |
| InChIKey | MGYGFNQQGAQEON-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])N=C=O)[2H] |
Computed by PubChem (NCBI)