Products 1219798-74-9
CAS 1219798-74-9 appears in our catalog under these names: 4-Methoxyphenyl-2,3,5,6-d4-acetonitrile, 98 atom % D, min 98% Chemical Purity, 4-Methoxyphenylacetonitrile-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2-(2,3,5,6-tetradeuterio-4-methoxyphenyl)acetonitrile (CAS 1219798-74-9) is a chemical compound with the molecular formula C9H9NO and a molecular weight of 151.20 g/mol. IUPAC name: 2-(2,3,5,6-tetradeuterio-4-methoxyphenyl)acetonitrile. InChIKey: PACGLQCRGWFBJH-QFFDRWTDSA-N.
| Molecular formula | C9H9NO |
|---|---|
| Molecular weight | 151.20 g/mol |
| IUPAC name | 2-(2,3,5,6-tetradeuterio-4-methoxyphenyl)acetonitrile |
| InChIKey | PACGLQCRGWFBJH-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC#N)[2H])[2H])OC)[2H] |
Computed by PubChem (NCBI)