CAS 1219798-76-1 appears in our catalog under these names: p-Toluic Acid-d7, >95% (HPLC), p-Toluic-d7 Acid, 98 atom % D, min 98% Chemical Purity, p–Toluic acid–d7, p-Toluic acid-d7, 99.72%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 1g, 0,5g, 10mg, 25mg, 5mg.
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzoic acid (CAS 1219798-76-1) is a chemical compound with the molecular formula C8H8O2 and a molecular weight of 143.19 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzoic acid. InChIKey: LPNBBFKOUUSUDB-AAYPNNLASA-N.
| Molecular formula | C8H8O2 |
|---|---|
| Molecular weight | 143.19 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzoic acid |
| InChIKey | LPNBBFKOUUSUDB-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)