Products 1219798-83-0
CAS 1219798-83-0 appears in our catalog under these names: Acetaldehyde Dimethyl Acetal-d10, 98 atom % D, min 98% Chemical Purity, Acetaldehyde Dimethyl Acetal–d10. Offered by: CDN, GLPBio. Available pack sizes: 0,5g, 0,25g, 5mg.
1,1,1,2-tetradeuterio-2,2-bis(trideuteriomethoxy)ethane (CAS 1219798-83-0) is a chemical compound with the molecular formula C4H10O2 and a molecular weight of 100.18 g/mol. IUPAC name: 1,1,1,2-tetradeuterio-2,2-bis(trideuteriomethoxy)ethane. InChIKey: SPEUIVXLLWOEMJ-LSURFNHSSA-N.
| Molecular formula | C4H10O2 |
|---|---|
| Molecular weight | 100.18 g/mol |
| IUPAC name | 1,1,1,2-tetradeuterio-2,2-bis(trideuteriomethoxy)ethane |
| InChIKey | SPEUIVXLLWOEMJ-LSURFNHSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(OC([2H])([2H])[2H])OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
acetaldehyde dimethyl acetal-d10