Products 1219798-85-2
CAS 1219798-85-2 is the registry number for 4-Methylpiperidine-2,2,6,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
2,2,6,6-tetradeuterio-4-methylpiperidine (CAS 1219798-85-2) is a chemical compound with the molecular formula C6H13N and a molecular weight of 103.20 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-4-methylpiperidine. InChIKey: UZOFELREXGAFOI-CQOLUAMGSA-N.
| Molecular formula | C6H13N |
|---|---|
| Molecular weight | 103.20 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-4-methylpiperidine |
| InChIKey | UZOFELREXGAFOI-CQOLUAMGSA-N |
| SMILES | [2H]C1(CC(CC(N1)([2H])[2H])C)[2H] |
Computed by PubChem (NCBI)